CAS 13177-32-7
:8-Nitrofluoranthene
Description:
8-Nitrofluoranthene is an organic compound characterized by the presence of a nitro group (-NO2) attached to the fluoranthene structure, which is a polycyclic aromatic hydrocarbon (PAH). This compound typically exhibits a yellow to orange color and is known for its potential applications in organic electronics and as a precursor in the synthesis of other chemical entities. The nitro group introduces significant polarity and can influence the compound's reactivity, making it a subject of interest in various chemical studies, including those related to environmental chemistry and toxicology. 8-Nitrofluoranthene is also noted for its potential mutagenic properties, which raises concerns regarding its environmental impact and safety. Its solubility characteristics can vary depending on the solvent, and it may exhibit fluorescence, making it useful in certain analytical applications. Overall, 8-Nitrofluoranthene serves as an important compound in both research and industrial contexts, particularly in the study of PAHs and their derivatives.
Formula:C16H9NO2
InChI:InChI=1S/C16H9NO2/c18-17(19)11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H
InChI key:InChIKey=CTBYAQPHRFINGO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C3=C4C(C2=CC1)=CC=CC4=CC=C3
Synonyms:- 8-Nitrofluoranthene
- Fluoranthene, 8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
