
CAS 13177-71-4
:5,6-Dihydrofuro[2,3-d]pyridazine-4,7-dione
Description:
5,6-Dihydrofuro[2,3-d]pyridazine-4,7-dione, with the CAS number 13177-71-4, is a heterocyclic organic compound characterized by its fused ring structure, which includes both furan and pyridazine moieties. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups, including carbonyls, which can participate in various chemical reactions such as nucleophilic additions and cycloadditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The compound may also display interesting physical properties, such as solubility in organic solvents and potential fluorescence, depending on its specific substituents and the environment. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, making it a subject of interest for further research in organic synthesis and material science. Overall, 5,6-Dihydrofuro[2,3-d]pyridazine-4,7-dione represents a unique class of compounds with potential utility in various chemical applications.
Formula:C6H4N2O3
InChI:InChI=1S/C6H4N2O3/c9-5-3-1-2-11-4(3)6(10)8-7-5/h1-2H,(H,7,9)(H,8,10)
InChI key:InChIKey=XXMXJZGHLGISEA-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(=O)NN1)OC=C2
Synonyms:- 5,6-Dihydrofuro[2,3-d]pyridazine-4,7-dione
- Furo[2,3-d]pyridazine-4,7-dione, 5,6-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.