CymitQuimica logo

CAS 131771-31-8

:

3-(IODOMETHYL)-4-(1H,1H-PERFLUORONONYL)TETRAHYDROFURAN

Description:
3-(Iodomethyl)-4-(1H,1H-perfluorononyl)tetrahydrofuran is a specialized chemical compound characterized by its unique molecular structure, which includes a tetrahydrofuran ring substituted with both an iodomethyl group and a perfluorononyl group. The presence of the iodomethyl group introduces a halogen, which can enhance reactivity and influence the compound's physical properties, such as solubility and boiling point. The perfluorononyl group, consisting of a long carbon chain fully substituted with fluorine atoms, imparts significant hydrophobic characteristics and thermal stability, making the compound potentially useful in applications requiring low surface energy or chemical resistance. This compound is likely to exhibit unique interactions in various chemical environments due to the combination of polar and nonpolar characteristics. Its specific applications may include use in advanced materials, surfactants, or as intermediates in organic synthesis. However, due to the presence of iodine and fluorinated groups, safety and environmental considerations are paramount when handling this substance.
Formula:C14H10F17IO
InChI:InChI=1/C14H10F17IO/c15-7(16,1-5-3-33-4-6(5)2-32)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h5-6H,1-4H2
SMILES:C(C1COCC1CI)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)-tetrahydro-4-(iodomethyl)-furan
  • 3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)-4-(Iodomethyl)Tetrahydrofuran
  • 3-(IODOMETHYL)-4-(1H,1H-PERFLUORONONYL)TETRAHYDROFURAN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.