CAS 131780-48-8

3(2H)-Quinazolinecarboxylic acid, 1,4-dihydro-2-oxo-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, monohydrochloride, endo-

Description:

3(2H)-Quinazolinecarboxylic acid, 1,4-dihydro-2-oxo-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, monohydrochloride, endo- is a complex organic compound characterized by its bicyclic structure and the presence of a quinazoline moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an ester linkage that indicates it can undergo hydrolysis. The bicyclic framework, specifically the azabicyclo[3.2.1]octane structure, suggests potential biological activity, as many compounds with similar frameworks are known for their pharmacological properties. The monohydrochloride form indicates that the compound is a salt, which can enhance its solubility in aqueous environments, making it more bioavailable. The presence of the methyl group at the 8-position may influence its steric and electronic properties, potentially affecting its interaction with biological targets. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₇H₂₁N₃O₃·ClH

InChI: InChI=1/C17H21N3O3.ClH/c1-19-12-6-7-13(19)9-14(8-12)23-17(22)20-10-11-4-2-3-5-15(11)18-16(20)21;/h2-5,12-14H,6-10H2,1H3,(H,18,21);1H/t12-,13+,14+;

InChI key: InChIKey=FDERDDSQHZRNGC-MGMJSKNANA-N

SMILES: C(O[C@H]1C[C@@]2(N(C)[C@](C1)(CC2)[H])[H])(=O)N3CC=4C(NC3=O)=CC=CC4.Cl

Synonyms:

• 3(2H)-Quinazolinecarboxylic acid, 1,4-dihydro-2-oxo-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, monohydrochloride, endo-

DAU 5884 (hydrochloride)

CAS: 131780-48-8

Formula: C₁₇H₂₂ClN₃O₃

Molecular weight: 351.8279

Ref: IN-DA01ENGN

Dau 5884 hydrochloride

CAS: 131780-48-8

Dau 5884 hydrochloride is a dopamine precursor that promotes the synthesis and release of dopamine. It has been used to treat neurological disorders, such as Parkinson's disease. Dau 5884 hydrochloride is also used to treat dopamine deficiency, which can result from a number of conditions such as aging or a brain injury.

Formula: C₁₇H₂₂ClN₃O₃

Purity: Min. 95%

Molecular weight: 351.8 g/mol

Ref: 3D-GFA78048

DAU 5884 hydrochloride

CAS: 131780-48-8

muscarinic M3 receptor antagonist

Formula: C₁₇H₂₂ClN₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 351.83

Ref: TM-T22709