CymitQuimica logo

CAS 131786-47-5

:

5-METHYL-2-(2-PYRIDINYL)-1,3-THIAZOL-4-OL

Description:
5-Methyl-2-(2-pyridinyl)-1,3-thiazol-4-ol is a heterocyclic compound characterized by the presence of a thiazole ring, which contains both sulfur and nitrogen atoms, and a pyridine moiety. This compound features a hydroxyl group (-OH) at the 4-position of the thiazole ring, contributing to its potential as a biologically active molecule. The methyl group at the 5-position enhances its lipophilicity, which can influence its solubility and permeability in biological systems. The pyridine ring, known for its aromaticity and basicity, may participate in various interactions, including hydrogen bonding and coordination with metal ions. This compound may exhibit antimicrobial, antifungal, or other pharmacological activities, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many heterocycles, the synthesis and reactivity of this compound can be influenced by the presence of functional groups and the overall electronic environment of the molecule.
Formula:C9H8N2OS
InChI:InChI=1/C9H8N2OS/c1-6-8(12)11-9(13-6)7-4-2-3-5-10-7/h2-5,12H,1H3
SMILES:Cc1c(nc(c2ccccn2)s1)O
Synonyms:
  • 4-Thiazolol, 5-Methyl-2-(2-Pyridinyl)-
  • 5-Methyl-2-(pyridin-2-yl)-1,3-thiazol-4-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.