CymitQuimica logo

CAS 13180-38-6

:

Quinoline, heptafluoro-

Description:
Quinoline, heptafluoro- is a fluorinated derivative of quinoline, characterized by the presence of seven fluorine atoms attached to its aromatic ring structure. This compound is typically a colorless to pale yellow liquid with a distinctive odor. Its molecular structure contributes to its unique chemical properties, including high thermal stability and low volatility. The presence of multiple fluorine atoms enhances its hydrophobicity and chemical inertness, making it resistant to many chemical reactions. Quinoline derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as solvents or intermediates in organic synthesis. Additionally, the heptafluorinated nature of this compound may impart specific characteristics such as increased lipophilicity and altered biological activity compared to non-fluorinated analogs. Safety data indicates that, like many fluorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, quinoline, heptafluoro- represents a specialized compound with potential utility in various chemical and industrial applications.
Formula:C9F7N
InChI:InChI=1/C9F7N/c10-2-1-3(11)7(15)9(16)17-8(1)6(14)5(13)4(2)12
SMILES:c12c(c(c(c(c2nc(c(c1F)F)F)F)F)F)F
Synonyms:
  • Heptafluoroquinoline
  • Quinoline, heptafluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.