CAS 131802-60-3

7-BENZYLOXYQUINOLINE

Description:

7-Benzyloxyquinoline is an organic compound characterized by the presence of a quinoline ring system substituted with a benzyloxy group at the 7-position. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential for various chemical reactions. It is often used in research and development, particularly in the fields of medicinal chemistry and organic synthesis, due to its ability to act as a ligand or a precursor in the synthesis of more complex molecules. The presence of the benzyloxy group enhances its solubility in organic solvents and may influence its biological activity. Additionally, 7-Benzyloxyquinoline may exhibit fluorescence, making it useful in analytical applications. Its chemical behavior can be influenced by factors such as pH and the presence of other functional groups, which can affect its reactivity and interaction with biological systems. Overall, 7-Benzyloxyquinoline is a versatile compound with potential applications in various scientific fields.

Formula: C₁₆H₁₃NO

InChI: InChI=1/C16H13NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15/h1-11H,12H2

SMILES: c1ccc(cc1)COc1ccc2cccnc2c1

Synonyms:

• Quinolino, 7-(phenylmethoxy)-

Quinoline, 7-(phenylmethoxy)-

CAS: 131802-60-3

Formula: C₁₆H₁₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 235.2805

Ref: IN-DA000ZRN

7-(Benzyloxy)quinoline

CAS: 131802-60-3

7-(Benzyloxy)quinoline

Purity: 97%

Molecular weight: 235.28g/mol

Ref: 54-OR88043

7-(Benzyloxy)quinoline

CAS: 131802-60-3

Purity: 97.0%

Molecular weight: 235.28599548339844

Ref: 10-F544293

7-Benzyloxyquinoline

CAS: 131802-60-3

Formula: C₁₆H₁₃NO

Purity: ≥ 98.5%

Color and Shape: White or off-white powder

Molecular weight: 235.28

Ref: 7W-GK0634

7-Benzyloxyquinoline

Controlled Product

CAS: 131802-60-3

Formula: C₁₆H₁₃NO

Color and Shape: Neat

Molecular weight: 235.28

Ref: TR-B120945