CymitQuimica logo

CAS 131819-22-2

:

1,2,3-trifluoro-5-(trans-4-pentylcyclohexyl)benzene

Description:
1,2,3-Trifluoro-5-(trans-4-pentylcyclohexyl)benzene is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms and a pentylcyclohexyl group. The trifluoromethyl groups introduce significant polarity and influence the compound's physical properties, such as boiling point and solubility. The trans-4-pentylcyclohexyl substituent contributes to the compound's steric bulk and can affect its conformational flexibility. This compound is likely to exhibit unique thermal and optical properties, making it of interest in materials science, particularly in the development of liquid crystals or other advanced materials. Its fluorinated nature may also impart chemical stability and resistance to degradation. The presence of multiple functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific reactivity and interaction with other substances would depend on the overall molecular structure and the environment in which it is used.
Formula:C17H23F3
InChI:InChI=1/C17H23F3/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-15(18)17(20)16(19)11-14/h10-13H,2-9H2,1H3/t12-,13-
SMILES:CCCCC[C@H]1CC[C@@H](CC1)c1cc(c(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.