CAS 13183-01-2

1-Methyl-1H-benzotriazol-7-amine

Description:

1-Methyl-1H-benzotriazol-7-amine, with the CAS number 13183-01-2, is an organic compound that belongs to the class of benzotriazoles, which are known for their applications in various fields, including photography, corrosion inhibition, and as UV stabilizers in plastics. This compound features a benzotriazole core with a methyl group and an amino group, contributing to its unique chemical properties. It is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents. The presence of the amino group allows for potential reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit UV-absorbing properties, making it useful in formulations that require protection from ultraviolet light. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many benzotriazole derivatives, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula: C₇H₈N₄

InChI: InChI=1S/C7H8N4/c1-11-7-5(8)3-2-4-6(7)9-10-11/h2-4H,8H2,1H3

InChI key: InChIKey=SUQCICOFGWTRRV-UHFFFAOYSA-N

SMILES: NC1=C2C(=CC=C1)N=NN2C

Synonyms:

• 1H-Benzotriazol-7-amine, 1-methyl-
• 1-Methyl-1H-benzotriazol-7-amine
• 7-Amino-1-methyl-1,2,3-benzotriazole
• 1-Methyl-1H-1,2,3-benzotriazol-7-amine
• 1H-Benzotriazole, 7-amino-1-methyl-