CAS 13183-09-0
:4-bromo-3-phenyl-1,2,3-oxadiazol-3-ium-5-olate
Description:
4-Bromo-3-phenyl-1,2,3-oxadiazol-3-ium-5-olate is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. The compound features a bromine substituent at the 4-position and a phenyl group at the 3-position, contributing to its unique chemical properties. The oxadiazolium structure indicates that it possesses a positive charge, which can influence its reactivity and interactions with other chemical species. This compound is likely to exhibit interesting electronic properties due to the conjugation between the aromatic phenyl group and the heterocyclic system. Additionally, the presence of the bromine atom may enhance its reactivity in nucleophilic substitution reactions. Such compounds are often studied for their potential applications in materials science, pharmaceuticals, and as intermediates in organic synthesis. However, specific physical properties such as solubility, melting point, and spectral characteristics would require experimental determination or detailed literature references for comprehensive understanding.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-7-8(12)13-10-11(7)6-4-2-1-3-5-6/h1-5H
Synonyms:- 4-Bromo-3-phenyl-1,2,3-oxadiazol-3-ium-5-olate
- 1,2,3-oxadiazolium, 4-bromo-5-hydroxy-3-phenyl-, inner salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3-Oxadiazolium, 4-bromo-5-hydroxy-3-phenyl-, inner salt
CAS:Formula:C8H5BrN2O2Molecular weight:241.0415
