CymitQuimica logo

CAS 13183-10-3

:

N-(1-Methyl-1H-benzimidazol-7-yl)acetamide

Description:
N-(1-Methyl-1H-benzimidazol-7-yl)acetamide, with the CAS number 13183-10-3, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an acetamide functional group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar organic solvents. The presence of the methyl group on the benzimidazole ring can influence its biological activity, making it of interest in pharmaceutical research. The compound may exhibit various properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C10H11N3O
InChI:InChI=1S/C10H11N3O/c1-7(14)12-9-5-3-4-8-10(9)13(2)6-11-8/h3-6H,1-2H3,(H,12,14)
InChI key:InChIKey=BLLJYUHYUJRPRO-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C2C(N=CN2C)=CC=C1
Synonyms:
  • Acetamide, N-(1-methyl-1H-benzimidazol-7-yl)-
  • Acetamide, N-(1-methyl-7-benzimidazolyl)-
  • N-(1-Methyl-1H-benzimidazol-7-yl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.