
CAS 131844-31-0
:rel-(1R,2S)-2-(4-Chlorophenyl)cyclopropanamine
Description:
Rel-(1R,2S)-2-(4-Chlorophenyl)cyclopropanamine is a chemical compound characterized by its cyclopropane structure, which features a chiral center that contributes to its stereochemistry. The presence of a 4-chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and biological activity. This compound is typically classified as an amine due to the presence of an amine functional group (-NH2), which can participate in hydrogen bonding and affect its solubility in various solvents. The stereochemistry (1R,2S) suggests specific spatial arrangements of atoms, which can be crucial for its interaction with biological targets, potentially impacting its pharmacological properties. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential effects on neurotransmitter systems. Overall, the unique structural features of rel-(1R,2S)-2-(4-Chlorophenyl)cyclopropanamine contribute to its chemical behavior and potential applications in various fields.
Formula:C9H10ClN
InChI:InChI=1/C9H10ClN/c10-7-3-1-6(2-4-7)8-5-9(8)11/h1-4,8-9H,5,11H2/t8-,9+/s2
InChI key:InChIKey=VQLXPSANRSPTEZ-BRJQIKQINA-N
SMILES:N[C@H]1[C@@H](C1)C2=CC=C(Cl)C=C2
Synonyms:- [trans-2-(4-Chlorophenyl)cyclopropyl]amine
- rel-(1R,2S)-2-(4-Chlorophenyl)cyclopropanamine
- Cyclopropanamine, 2-(4-chlorophenyl)-, (1R,2S)-rel-
- Cyclopropanamine, 2-(4-chlorophenyl)-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.