
CAS 13185-53-0
:1-Methyl-1,2-cyclohexanedicarboxylic acid
Description:
1-Methyl-1,2-cyclohexanedicarboxylic acid, with the CAS number 13185-53-0, is an organic compound characterized by its dicarboxylic acid structure, featuring two carboxyl (-COOH) groups attached to a cyclohexane ring that also has a methyl group. This compound typically appears as a colorless to pale yellow solid and is soluble in polar solvents due to the presence of the carboxylic acid functional groups. It exhibits properties common to dicarboxylic acids, such as the ability to form esters and anhydrides, and can participate in various chemical reactions, including esterification and amidation. The presence of the methyl group influences its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. 1-Methyl-1,2-cyclohexanedicarboxylic acid may find applications in organic synthesis, polymer chemistry, and as an intermediate in the production of various chemical compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H14O4
InChI:InChI=1S/C9H14O4/c1-9(8(12)13)5-3-2-4-6(9)7(10)11/h6H,2-5H2,1H3,(H,10,11)(H,12,13)
InChI key:InChIKey=PMUPSYZVABJEKC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(C(O)=O)(C)CCCC1
Synonyms:- 1-Methyl-1,2-cyclohexanedicarboxylic acid
- 1,2-Cyclohexanedicarboxylic acid, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
