CAS 13185-73-4: Fructosazine
Description:Fructosazine, with the CAS number 13185-73-4, is a chemical compound that belongs to the class of glycosides. It is characterized by its structure, which typically includes a fructose moiety linked to an aromatic or aliphatic component. This compound is often studied for its potential applications in various fields, including pharmaceuticals and biochemistry, due to its unique properties. Fructosazine may exhibit biological activity, such as antioxidant or antimicrobial effects, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the specific conditions and the presence of other substances. As with many glycosides, the hydrolysis of fructosazine can yield sugars and aglycones, which may further contribute to its biological activity. Understanding the characteristics of fructosazine is essential for exploring its potential uses and mechanisms of action in biological systems.
Formula:C12H20N2O8
InChI:InChI=1S/C12H20N2O8/c15-3-7(17)11(21)9(19)5-1-13-6(2-14-5)10(20)12(22)8(18)4-16/h1-2,7-12,15-22H,3-4H2/t7-,8-,9-,10-,11-,12-/m1/s1
InChI key:InChIKey=NPWQIVOYGNUVEB-PAUJSFGCSA-N
SMILES:OCC(O)C(O)C(O)C1=NC=C(N=C1)C(O)C(O)C(O)CO
- Synonyms:
- (1R,1′R,2S,2′S,3R,3′R)-1,1′-(2,5-Pyrazinediyl)bis[1,2,3,4-butanetetrol]
- (1R,2S,3R,1'R,2'S,3'R)-1,1'-pyrazine-2,5-diyldibutane-1,2,3,4-tetrol
- 1,2,3,4-Butanetetrol, 1,1'-(2,5-pyrazinediyl)bis-, (1R-(1R*,1'*,2S*,2'S*,3R,3R*))
- 1,2,3,4-Butanetetrol, 1,1′-(2,5-pyrazinediyl)bis-, (1R,1′R,2S,2′S,3R,3′R)-
- 1,2,3,4-Butanetetrol, 1,1′-(2,5-pyrazinediyl)bis-, [1R-[1R*(1′R*,2′S*,3′R*),2S*,3R*]]-
- 1,2,3,4-Butanetetrol, 1,1′-(2,5-pyrazinediyl)di-, <span class="text-smallcaps">D</span>-arabino-
- Fructosazine
- 1,2,3,4-Butanetetrol, 1,1′-(2,5-pyrazinediyl)di-, D-arabino-
