CAS 131857-29-9

1-methylpyrrolidine-2,2,3,3,4,4,5,5-D8

Description:

1-Methylpyrrolidine-2,2,3,3,4,4,5,5-D8, with the CAS number 131857-29-9, is a deuterated derivative of 1-methylpyrrolidine, a five-membered heterocyclic amine. The presence of deuterium atoms (D) in place of hydrogen enhances its stability and alters its physical properties, making it useful in various applications, particularly in NMR spectroscopy and studies involving isotopic labeling. This compound retains the basic structural characteristics of pyrrolidine, which includes a saturated ring with one nitrogen atom and four carbon atoms. The methyl group attached to the nitrogen contributes to its basicity and nucleophilicity. Due to its unique isotopic composition, 1-methylpyrrolidine-D8 is often employed in research to trace reaction pathways or to study molecular dynamics. Its solubility in organic solvents and relatively low toxicity make it suitable for laboratory use. Overall, this compound serves as a valuable tool in both synthetic chemistry and analytical applications, particularly in the context of studying reaction mechanisms and molecular interactions.

Formula: C₅H₃D₈N

InChI: InChI=1/C5H11N/c1-6-4-2-3-5-6/h2-5H2,1H3/i2D2,3D2,4D2,5D2

SMILES: CN1C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]

Synonyms:

• 2,2,3,3,4,4,5,5-Octadeuterio-1-Methyl-Pyrrolidine

1-Methylpyrrolidine-d8

Controlled Product

CAS: 131857-29-9

Applications is a labelled analogue of N-Methylpyrrolidine (M326210), a compound that is used as a base in synthetic chemistry. N-Methylpyrrolidine has also been known to exert a Nicotine(N412420)-like effect on isolated smooth muscle preparations.

Formula: C₅H₃D₈N

Color and Shape: Neat

Molecular weight: 93.2

Ref: TR-M326211

Pyrrolidine-2,2,3,3,4,4,5,5-d8, 1-methyl- (9CI)

CAS: 131857-29-9

Formula: C₅H₃D₈N

Molecular weight: 93.1968

Ref: IN-DA000ZU8