CAS 13186-19-1

6-O-Galloyl-D-glucose

Description:

6-O-Galloyl-D-glucose is a phenolic compound derived from glucose, characterized by the presence of a galloyl group attached to the 6-position of the glucose molecule. This compound is part of the larger family of galloyl esters, which are known for their antioxidant properties and potential health benefits. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohol. The presence of the galloyl moiety contributes to its biological activity, including anti-inflammatory and antimicrobial effects. 6-O-Galloyl-D-glucose is often studied for its role in traditional medicine and its potential applications in food preservation and nutraceuticals. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it an interesting subject for research in both organic chemistry and pharmacology. Overall, this compound exemplifies the intersection of natural product chemistry and health sciences, highlighting the importance of plant-derived substances in therapeutic applications.

Formula: C₁₃H₁₆O₁₀

InChI: InChI=1S/C13H16O10/c14-3-8(17)11(20)12(21)9(18)4-23-13(22)5-1-6(15)10(19)7(16)2-5/h1-3,8-9,11-12,15-21H,4H2/t8-,9+,11+,12+/m0/s1

InChI key: InChIKey=SMZJCCHIPATQCN-LUTQBAROSA-N

SMILES: C(OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)(=O)C1=CC(O)=C(O)C(O)=C1

Synonyms:

• 6-O-Galloyl-D-glucose
• 6-Galloylglucose
• D-Glucose, 6-(3,4,5-trihydroxybenzoate)
• D-Glucose, 6-gallate
• 6-O-Galloylglucose

D-Glucose, 6-(3,4,5-trihydroxybenzoate)

CAS: 13186-19-1

Formula: C₁₃H₁₆O₁₀

Color and Shape: Solid

Molecular weight: 332.2601

Ref: IN-DA000ZUF