CymitQuimica logo

CAS 131860-39-4

:

Benzeneacetic acid, 2-[[6-(2-aminophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene)-, methyl ester, (E)-

Description:
Benzeneacetic acid, 2-[[6-(2-aminophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene)-, methyl ester, (E)-, identified by CAS number 131860-39-4, is a chemical compound characterized by its complex structure that includes a benzeneacetic acid moiety, a pyrimidine ring, and an ether linkage. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, reactivity, and biological activity. It is likely to be a polar molecule due to the presence of functional groups such as the methoxy and amino groups, which can engage in hydrogen bonding. The (E)- configuration indicates a specific geometric arrangement around a double bond, which can affect its interaction with biological targets. Compounds of this nature are often investigated for their potential pharmacological properties, including anti-inflammatory or anticancer activities, due to the presence of the pyrimidine and phenoxy groups that are common in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C21H19N3O5
InChI:InChI=1S/C21H19N3O5/c1-26-12-15(21(25)27-2)14-7-3-5-9-17(14)28-19-11-20(24-13-23-19)29-18-10-6-4-8-16(18)22/h3-13H,22H2,1-2H3/b15-12+
InChI key:InChIKey=VZYLPSDEXQZULY-NTCAYCPXSA-N
SMILES:C(\C(OC)=O)(=C/OC)/C1=C(OC=2C=C(OC3=C(N)C=CC=C3)N=CN2)C=CC=C1
Synonyms:
  • Benzeneacetic acid, 2-[[6-(2-aminophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene)-, methyl ester, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.