CAS 131865-53-7

N-succinimidyl 8-((4'-fluorobenzyl)amino)suberate

Description:

N-succinimidyl 8-((4'-fluorobenzyl)amino)suberate, with the CAS number 131865-53-7, is a chemical compound that belongs to the class of succinimidyl esters, which are commonly used in bioconjugation and labeling applications. This compound features a succinimidyl moiety that facilitates the formation of stable amide bonds with primary amines, making it useful for attaching various biomolecules, such as proteins or peptides. The presence of the 4'-fluorobenzyl group enhances its reactivity and may also influence the compound's solubility and stability in biological systems. Additionally, the suberate chain contributes to the overall hydrophobic character of the molecule, which can affect its interaction with biological membranes. This compound is typically utilized in research settings for the development of targeted therapeutics or diagnostic agents, owing to its ability to selectively label biomolecules. As with many chemical substances, proper handling and safety precautions are essential due to potential reactivity and toxicity.

Formula: C₁₉H₂₃FN₂O₅

InChI: InChI=1/C19H23FN2O5/c20-15-9-7-14(8-10-15)13-21-16(23)5-3-1-2-4-6-19(26)27-22-17(24)11-12-18(22)25/h7-10H,1-6,11-13H2,(H,21,23)

SMILES: C(CCCC(=O)ON1C(=O)CCC1=O)CCC(=NCc1ccc(cc1)F)O

Synonyms:

• Sfbs
• Octanamide, 8-((2,5-dioxo-1-pyrrolidinyl)oxy)-N-((4-fluorophenyl)methyl)-8-oxo-
• 8-[(2,5-dioxopyrrolidin-1-yl)oxy]-N-(4-fluorobenzyl)-8-oxooctanamide
• N-Succinimidyl 8-((4'-fluorobenzyl)amino)suberate