
CAS 13187-38-7
:5-Chloro-2-methoxy-2,4,6-cycloheptatrien-1-one
Description:
5-Chloro-2-methoxy-2,4,6-cycloheptatrien-1-one is an organic compound characterized by its unique bicyclic structure, which includes a cycloheptatriene framework. This compound features a chloro substituent at the 5-position and a methoxy group at the 2-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl group (ketone) at the 1-position enhances its electrophilic character, making it a useful intermediate in various chemical reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing effects of the chlorine atom and the electron-donating nature of the methoxy group, which can affect its reactivity in nucleophilic substitution and addition reactions. Additionally, the compound may display interesting optical properties due to its conjugated system, making it of interest in materials science and organic electronics. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H7ClO2
InChI:InChI=1S/C8H7ClO2/c1-11-8-5-3-6(9)2-4-7(8)10/h2-5H,1H3
InChI key:InChIKey=DZWLFJSHGQBDIT-UHFFFAOYSA-N
SMILES:O(C)C=1C(=O)C=CC(Cl)=CC1
Synonyms:- 5-Chloro-2-methoxy-2,4,6-cycloheptatrien-1-one
- 2,4,6-Cycloheptatrien-1-one, 5-chloro-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
