CAS 1318735-00-0
:(2R)-2-Methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]-1-piperidinyl]phenoxy]-1,2-propanediol
Description:
The chemical substance known as (2R)-2-Methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]-1-piperidinyl]phenoxy]-1,2-propanediol, with the CAS number 1318735-00-0, is characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a chiral center at the 2-position, indicating that it exists in two enantiomeric forms, with the (R) configuration being specified. The presence of a trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. The compound also contains a piperidine moiety, which is often associated with pharmacological properties, suggesting potential applications in medicinal chemistry. Its structure indicates that it may interact with various biological targets, making it of interest in drug development. Additionally, the presence of hydroxyl groups suggests potential for hydrogen bonding, which could affect solubility and reactivity. Overall, this compound's unique features position it as a candidate for further investigation in therapeutic contexts.
Formula:C22H26F3NO5
InChI:InChI=1S/C22H26F3NO5/c1-21(28,14-27)15-29-17-4-2-16(3-5-17)26-12-10-19(11-13-26)30-18-6-8-20(9-7-18)31-22(23,24)25/h2-9,19,27-28H,10-15H2,1H3/t21-/m1/s1
InChI key:InChIKey=HLDIJEYVAMSFEY-OAQYLSRUSA-N
SMILES:O(C[C@](CO)(C)O)C1=CC=C(C=C1)N2CCC(OC3=CC=C(OC(F)(F)F)C=C3)CC2
Synonyms:- (2R)-2-Methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]-1-piperidinyl]phenoxy]-1,2-propanediol
- 1,2-Propanediol, 2-methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]-1-piperidinyl]phenoxy]-, (2R)-
- (R)-2-methyl-3-(4-{4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl}phenoxy)propane-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
