CymitQuimica logo

CAS 131875-38-2

:

3-morpholin-4-yl-1H-indazol-5-amine

Description:
3-Morpholin-4-yl-1H-indazol-5-amine, with the CAS number 131875-38-2, is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a morpholine group at the 4-position of the indazole ring contributes to its unique properties, including potential solubility in polar solvents and the ability to engage in hydrogen bonding due to the morpholine's ether and amine functionalities. This compound is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to drug development, such as anti-cancer or anti-inflammatory effects. Its structure allows for various modifications, which can influence its pharmacokinetic and pharmacodynamic profiles. As with many heterocyclic compounds, the specific arrangement of atoms and functional groups can significantly impact its reactivity and interactions with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and industrial applications.
Formula:C11H14N4O
InChI:InChI=1/C11H14N4O/c12-8-1-2-10-9(7-8)11(14-13-10)15-3-5-16-6-4-15/h1-2,7H,3-6,12H2,(H,13,14)
Synonyms:
  • 3-(Morpholin-4-yl)-1H-indazol-5-amine
  • 1H-indazol-5-amine, 3-(4-morpholinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.