CAS 131880-56-3
:2,3-Dihydro-3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride
Description:
2,3-Dihydro-3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride, with the CAS number 131880-56-3, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the sulfonyl chloride group indicates that it can act as a sulfonating agent, making it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. The dimethyl and keto substituents contribute to its unique reactivity and stability profile. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, would typically depend on the specific conditions and purity of the sample. Overall, this compound is significant in organic synthesis and potentially in pharmaceutical development.
Formula:C10H10ClNO3S
InChI:InChI=1S/C10H10ClNO3S/c1-10(2)7-5-6(16(11,14)15)3-4-8(7)12-9(10)13/h3-5H,1-2H3,(H,12,13)
InChI key:InChIKey=ZSQGKDCXTIYZSF-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(NC1=O)=CC=C(S(Cl)(=O)=O)C2
Synonyms:- 2,3-Dihydro-3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride
- 1H-Indole-5-sulfonyl chloride, 2,3-dihydro-3,3-dimethyl-2-oxo-
- 3,3-Dimethyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride
- 1H-indole-5-sulfonyl chloride, 2,3-dihydro-3,3-dimethyl-2-
- 3,3-dimethyl-2-oxoindoline-5-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.