CAS 131887-48-4
:2-benzylmorpholine
Description:
2-Benzylmorpholine is an organic compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a benzyl group at the second position of the morpholine ring contributes to its unique properties. This compound typically appears as a colorless to pale yellow liquid and has a distinctive aromatic odor. It is soluble in organic solvents and exhibits moderate polarity due to the morpholine moiety. 2-Benzylmorpholine is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of pharmaceuticals or as a ligand in coordination chemistry. Its chemical reactivity is influenced by the nitrogen atom, which can participate in hydrogen bonding and nucleophilic reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 2-benzylmorpholine is a versatile compound with potential applications in chemical synthesis and research.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h1-5,11-12H,6-9H2
Synonyms:- 2-Benzylmorpholine
- Morpholine, 2-(phenylmethyl)-, (-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
