CAS 131894-91-2
:1-N-HEPTYL-4-IODOBENZENE
Description:
1-N-Heptyl-4-iodobenzene is an organic compound characterized by its structure, which consists of a heptyl group (a seven-carbon straight-chain alkyl group) attached to a benzene ring that has an iodine atom substituted at the para position. This compound is part of the class of aryl halides, where the iodine atom contributes to its reactivity and potential applications in organic synthesis. The presence of the heptyl group imparts hydrophobic characteristics, making the compound less soluble in water but more soluble in organic solvents. Its molecular structure suggests that it may exhibit interesting physical properties, such as a relatively high boiling point compared to simpler aromatic compounds due to the larger heptyl group. Additionally, the iodine substituent can facilitate nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex organic molecules. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C13H19I
InChI:InChI=1/C13H19I/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7H2,1H3
SMILES:CCCCCCCc1ccc(cc1)I
Synonyms:- 1-Heptyl-4-Iodo-Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-n-Heptyl-4-iodobenzene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H19IPurity:98%Color and Shape:Liquid, Clear colorless to yellowMolecular weight:302.20


