CAS 13190-97-1
:Solanesol
Description:
Solanesol is a natural polyisoprenoid alcohol, primarily derived from the leaves of the tobacco plant, Nicotiana tabacum. It is characterized by its long hydrocarbon chain, which consists of multiple isoprene units, contributing to its hydrophobic properties. Solanesol is typically a colorless to pale yellow liquid and is known for its high molecular weight and viscosity. It is soluble in organic solvents but has limited solubility in water due to its non-polar nature. This compound has garnered interest in various fields, including pharmaceuticals and cosmetics, due to its potential antioxidant and anti-inflammatory properties. Additionally, solanesol serves as a precursor for the synthesis of other compounds, including coenzyme Q10 and certain vitamins. Its unique structure and properties make it a subject of research in both natural product chemistry and industrial applications. As with many organic compounds, handling solanesol requires standard safety precautions to mitigate any potential health risks associated with exposure.
Formula:C45H74O
InChI:InChI=1S/C45H74O/c1-37(2)19-11-20-38(3)21-12-22-39(4)23-13-24-40(5)25-14-26-41(6)27-15-28-42(7)29-16-30-43(8)31-17-32-44(9)33-18-34-45(10)35-36-46/h19,21,23,25,27,29,31,33,35,46H,11-18,20,22,24,26,28,30,32,34,36H2,1-10H3/b38-21+,39-23+,40-25+,41-27+,42-29+,43-31+,44-33+,45-35+
InChI key:InChIKey=AFPLNGZPBSKHHQ-MEGGAXOGSA-N
SMILES:C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)/C)(\CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)/C
Synonyms:- (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-Nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-ol
- (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-ol
- 2,6,10,14,18,22,26,30,34-Hexatriacontanonaen-1-ol, 3,7,11,15,19,23,27,31,35-nonamethyl-, (2E,6E,10E,14E,18E,22E,26E,30E)-
- 2,6,10,14,18,22,26,30,34-Hexatriacontanonaen-1-ol, 3,7,11,15,19,23,27,31,35-nonamethyl-, (all-E)-
- 3,7,11,15,19,23,27,31,35-Nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-Nonaen-1-Ol
- Farnesylfarnesylfarnesol
- Nonaisoprenol
- Solanasol
- Solanesol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Solanesol
CAS:Formula:C45H74OPurity:>93.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:631.092,6,10,14,18,22,26,30,34-Hexatriacontanonaen-1-ol, 3,7,11,15,19,23,27,31,35-nonamethyl-, (2E,6E,10E,14E,18E,22E,26E,30E)-
CAS:Formula:C45H74OPurity:98%Color and Shape:SolidMolecular weight:631.0685Solanesol
CAS:Formula:C45H74OPurity:≥ 93.0%Color and Shape:White to off-white powderMolecular weight:631.07Solanesol
CAS:Solanesol (Betulanonaprenol) is a phytochemical present in tobacco leaf. Starting material for synthesis of co-enzyme Q10. Exhibits antiulcer activity.Formula:C45H74OPurity:97.60%Color and Shape:Brown Waxy SolidMolecular weight:631.07Solanesol (~90%)
CAS:Controlled ProductApplications A high molecular weight isoprenoid alcohol isolated from tobacco leaf.
Formula:C45H74OPurity:~90%Color and Shape:NeatMolecular weight:631.07Solanesol 35-(Bistrideuteromethyl)
CAS:Controlled ProductFormula:C45H68D6OColor and Shape:NeatMolecular weight:637.11Solanesol
CAS:Solanesol is a naturally occurring polyisoprenoid alcohol, which is derived from the leaves of tobacco plants. As a key intermediate, it has significant importance due to its chemical structure, which consists of numerous isoprene units that confer distinct properties valuable in various biochemical processes.
Formula:C45H74OPurity:Min. 95%Color and Shape:White PowderMolecular weight:631.07 g/mol









