
CAS 13191-15-6
:AraCTP
Description:
AraCTP, or 2'-deoxy-2'-C-methylcytidine 5'-triphosphate, is a nucleotide analog that plays a significant role in biochemical research and therapeutic applications. It is characterized by its structural similarity to natural nucleotides, which allows it to participate in nucleic acid synthesis and modulation of enzymatic activities. The compound is particularly noted for its ability to inhibit viral replication, making it of interest in antiviral drug development. AraCTP is typically used in studies involving DNA and RNA synthesis, as well as in the investigation of polymerase enzymes. Its unique properties stem from the presence of a modified sugar moiety, which enhances its stability and alters its interaction with nucleic acid polymerases. Additionally, AraCTP can influence cellular processes by acting as a substrate for various kinases and polymerases, thereby impacting nucleotide metabolism and signaling pathways. Overall, AraCTP serves as a valuable tool in molecular biology and pharmacology, contributing to our understanding of nucleic acid dynamics and potential therapeutic strategies.
Formula:C9H16N3O14P3
InChI:InChI=1S/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7+,8-/m1/s1
InChI key:InChIKey=PCDQPRRSZKQHHS-CCXZUQQUSA-N
SMILES:O[C@@H]1[C@@H](O[C@H](COP(OP(OP(=O)(O)O)(=O)O)(=O)O)[C@H]1O)N2C(=O)N=C(N)C=C2
Synonyms:- Cytosine, 1-β-D-arabinofuranosyl-, 5′-(tetrahydrogen triphosphate)
- 2(1H)-Pyrimidinone, 4-amino-1-[5-O-[hydroxy[[hydroxy(phosphonooxy)phosphinyl]oxy]phosphinyl]-β-D-arabinofuranosyl]-
- 4-Amino-1-[5-O-[hydroxy[[hydroxy(phosphonooxy)phosphinyl]oxy]phosphinyl]-β-D-arabinofuranosyl]-2(1H)-pyrimidinone
- Cytosine arabinoside 5′-triphosphate
- Cytosine, 1-β-D-arabinofuranosyl-, 5′-triphosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cytarabine triphosphate
CAS:Ara-CTP, active Cytarabine metabolite, inhibits DNA synthesis, predicts leukemic chemosensitivity.Formula:C9H16N3O14P3Color and Shape:SolidMolecular weight:483.16
