CymitQuimica logo

CAS 131912-34-0

:

1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-yl 4-methylbenzenesulfonate

Description:
1-[(4-methylphenyl)sulfonyl]pyrrolidin-3-yl 4-methylbenzenesulfonate, with the CAS number 131912-34-0, is a chemical compound characterized by its sulfonyl functional groups attached to a pyrrolidine ring. This compound features a pyrrolidine moiety, which is a five-membered nitrogen-containing heterocycle, and is substituted with sulfonyl groups that enhance its reactivity and solubility in various solvents. The presence of the 4-methylphenyl groups indicates that it has aromatic characteristics, contributing to its stability and potential interactions in biological systems. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in medicinal chemistry due to its structural features. Its sulfonate group can also impart ionic characteristics, making it useful in various chemical reactions. Overall, the unique combination of its functional groups and ring structure suggests that it may have specific applications in pharmaceuticals or materials science, although detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C18H21NO5S2
InChI:InChI=1/C18H21NO5S2/c1-14-3-7-17(8-4-14)25(20,21)19-12-11-16(13-19)24-26(22,23)18-9-5-15(2)6-10-18/h3-10,16H,11-13H2,1-2H3
SMILES:Cc1ccc(cc1)S(=O)(=O)N1CCC(C1)OS(=O)(=O)c1ccc(C)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.