CAS 131922-05-9
:Piperazine, 2-(trifluoromethyl)- (9CI)
Description:
Piperazine, 2-(trifluoromethyl)-, also known by its CAS number 131922-05-9, is a chemical compound characterized by the presence of a piperazine ring substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both piperazine derivatives and fluorinated organic compounds. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Piperazine derivatives are often explored for their potential pharmacological applications, including as anxiolytics, antidepressants, and in the treatment of various neurological disorders. The presence of the trifluoromethyl group may also impart unique reactivity and stability characteristics, affecting its interactions in chemical reactions and biological systems. Additionally, the compound's physical properties, such as solubility and boiling point, can be influenced by the trifluoromethyl substitution. Overall, Piperazine, 2-(trifluoromethyl)- is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C5H9F3N2
InChI:InChI=1/C5H9F3N2/c6-5(7,8)4-3-9-1-2-10-4/h4,9-10H,1-3H2
SMILES:C1CNC(CN1)C(F)(F)F
Synonyms:- 2-(Trifluoromethyl)piperazine
- Piperazine, 2-(trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(+/-)-2-(Trifluoromethyl)piperazine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H9F3N2Purity:97%Color and Shape:White to cream to yellow, PowderMolecular weight:154.14Piperazine, 2-(trifluoromethyl)-
CAS:Formula:C5H9F3N2Purity:97%Color and Shape:SolidMolecular weight:154.1336Ref: IN-DA000ZWP
1g123.00€5g340.00€10g691.00€25gTo inquire50gTo inquire100gTo inquire250gTo inquire100mg60.00€250mg76.00€2-(Trifluoromethyl)piperazine
CAS:<p>2-(Trifluoromethyl)piperazine</p>Purity:98%Molecular weight:154.13g/mol2-(Trifluoromethyl)piperazine
CAS:Formula:C5H9F3N2Purity:98%Color and Shape:SolidMolecular weight:154.136



