
CAS 131922-09-3
:Piperazine, 2-(5-chloro-2-furanyl)-
Description:
Piperazine, 2-(5-chloro-2-furanyl)- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 5-chloro-2-furanyl group indicates that a furan ring, substituted with a chlorine atom at the 5-position, is attached to the piperazine. This structure contributes to its potential biological activity and pharmacological properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific substituents and their interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety's known role in various drug formulations. Additionally, the chlorine substituent may influence the compound's reactivity and interaction with biological targets. As with many chemical substances, safety and handling precautions are essential, as the compound may possess toxicological properties that require careful assessment in laboratory settings.
Formula:C8H11ClN2O
InChI:InChI=1S/C8H11ClN2O/c9-8-2-1-7(12-8)6-5-10-3-4-11-6/h1-2,6,10-11H,3-5H2
InChI key:InChIKey=CQOYYHYWNFVPAN-UHFFFAOYSA-N
SMILES:ClC=1OC(=CC1)C2CNCCN2
Synonyms:- Piperazine, 2-(5-chloro-2-furanyl)-
- 2-(5-Chlorofuran-2-yl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.