CAS 131923-69-8
:2,7-dichloro-8-methylquinoline-3-carbaldehyde
Description:
2,7-Dichloro-8-methylquinoline-3-carbaldehyde is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing nitrogen. This compound features two chlorine atoms at the 2 and 7 positions and a methyl group at the 8 position, contributing to its unique reactivity and properties. The presence of the aldehyde functional group at the 3 position enhances its potential for further chemical transformations, making it a valuable intermediate in organic synthesis. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic nature, which can influence their solubility in organic solvents. Additionally, the chlorinated and methylated substitutions can affect the compound's electronic properties, potentially impacting its reactivity in electrophilic or nucleophilic reactions. Safety considerations should be taken into account, as halogenated compounds can pose environmental and health risks. Overall, 2,7-dichloro-8-methylquinoline-3-carbaldehyde is of interest in various fields, including pharmaceuticals and materials science, due to its structural characteristics and reactivity.
Formula:C11H7Cl2NO
InChI:InChI=1/C11H7Cl2NO/c1-6-9(12)3-2-7-4-8(5-15)11(13)14-10(6)7/h2-5H,1H3
SMILES:Cc1c(ccc2cc(C=O)c(Cl)nc12)Cl
Synonyms:- 3-Quinolinecarboxaldehyde, 2,7-Dichloro-8-Methyl-
- 2,7-Dichloro-8-methylquinoline-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
