
CAS 131929-90-3
:Cyclohexyl 1,1,1-trifluoromethanesulfonate
Description:
Cyclohexyl 1,1,1-trifluoromethanesulfonate, with the CAS number 131929-90-3, is an organofluorine compound characterized by the presence of a cyclohexyl group attached to a trifluoromethanesulfonate moiety. This compound is typically a colorless to pale yellow liquid and is known for its high reactivity due to the presence of the trifluoromethanesulfonate functional group, which can act as a leaving group in nucleophilic substitution reactions. The trifluoromethanesulfonate group imparts significant polarity and enhances the compound's solubility in polar solvents. Additionally, the presence of fluorine atoms contributes to its stability and resistance to hydrolysis compared to other sulfonate esters. Cyclohexyl 1,1,1-trifluoromethanesulfonate is often utilized in organic synthesis, particularly in the preparation of various fluorinated compounds, and may have applications in pharmaceuticals and agrochemicals. However, due to its potential environmental and health impacts, handling and disposal should be conducted with caution, following appropriate safety guidelines.
Formula:C7H11F3O3S
InChI:InChI=1S/C7H11F3O3S/c8-7(9,10)14(11,12)13-6-4-2-1-3-5-6/h6H,1-5H2
InChI key:InChIKey=VHLRUGZSAQKKLU-UHFFFAOYSA-N
SMILES:O(S(C(F)(F)F)(=O)=O)C1CCCCC1
Synonyms:- Methanesulfonic acid, 1,1,1-trifluoro-, cyclohexyl ester
- Methanesulfonic acid, trifluoro-, cyclohexyl ester
- Cyclohexyl triflate
- Cyclohexyl 1,1,1-trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
