CAS 13194-73-5
:3,5-Dibromo-4-methylaniline
Description:
3,5-Dibromo-4-methylaniline is an organic compound characterized by its aromatic amine structure, which features a benzene ring substituted with two bromine atoms and a methyl group. The presence of the amino group (-NH2) makes it a derivative of aniline, enhancing its reactivity and solubility in polar solvents. This compound typically appears as a solid at room temperature and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. The bromine substituents contribute to its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's molecular structure influences its physical properties, such as melting and boiling points, which are generally higher than those of unsubstituted aniline due to increased intermolecular interactions. Safety considerations are important when handling this compound, as brominated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.
Formula:C7H7Br2N
InChI:InChI=1/C7H7Br2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3
SMILES:Cc1c(cc(cc1Br)N)Br
Synonyms:- 3,5-Dibromo-p-toluidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Dibromo-4-methylaniline
CAS:Formula:C7H7Br2NPurity:>97.0%(GC)(T)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:264.953,5-Dibromo-4-methylaniline, 99%
CAS:3,5-Dibromo-4-methylaniline is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referFormula:C7H7Br2NPurity:99%Color and Shape:Crystals or powder or crystalline powder, Pale cream to cream to yellow to brownMolecular weight:264.95Benzenamine, 3,5-dibromo-4-methyl-
CAS:Formula:C7H7Br2NPurity:98%Color and Shape:SolidMolecular weight:264.94523,5-Dibromo-4-methylaniline
CAS:Formula:C7H7Br2NPurity:98%Color and Shape:SolidMolecular weight:264.948




