CymitQuimica logo

CAS 131941-25-8

:

2-(4-METHOXYPHENYL)-5-NITROPYRIDINE

Description:
2-(4-Methoxyphenyl)-5-nitropyridine, identified by its CAS number 131941-25-8, is an organic compound characterized by a pyridine ring substituted with both a methoxyphenyl group and a nitro group. The presence of the methoxy group enhances its lipophilicity and can influence its reactivity and solubility in organic solvents. The nitro group, known for its electron-withdrawing properties, can significantly affect the compound's electronic characteristics, making it potentially useful in various chemical reactions, including electrophilic substitutions. This compound may exhibit biological activity, which is often explored in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest potential applications in agrochemicals or as intermediates in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the specific conditions under which it is handled, including temperature and pH. Overall, 2-(4-methoxyphenyl)-5-nitropyridine represents a versatile structure in organic chemistry with implications in both research and industrial applications.
Formula:C12H10N2O3
InChI:InChI=1/C12H10N2O3/c1-17-11-5-2-9(3-6-11)12-7-4-10(8-13-12)14(15)16/h2-8H,1H3
InChI key:AQFGZIXPQOUSHT-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)c1ccc(cn1)N(=O)=O
Found 2 products.