CAS 131947-81-4
:2,4-DIMETHOXY-BENZAMIDINE HCL
Description:
2,4-Dimethoxy-benzamidine hydrochloride is a chemical compound characterized by its amidine functional group, which is known for its ability to act as a strong base and a nucleophile. This compound features a benzene ring substituted with two methoxy groups at the 2 and 4 positions, enhancing its solubility and reactivity. The presence of the amidine group contributes to its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in various applications, including research and pharmaceutical development. The compound may exhibit properties such as antimicrobial or antiviral activity, although specific biological effects would depend on further studies. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 2,4-Dimethoxy-benzamidine hydrochloride represents a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C9H13ClN2O2
InChI:InChI=1/C9H12N2O2.ClH/c1-12-6-3-4-7(9(10)11)8(5-6)13-2;/h3-5H,1-2H3,(H3,10,11);1H
SMILES:COc1ccc(c(c1)OC)C(=N)N.Cl
Synonyms:- 2,4-Dimethoxy-Benzamidine Hydrochloride
- 2,4-Dimethoxybenzenecarboximidamide Hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
