CAS 131956-33-7
:depsidomycin
Description:
Depsidomycin is a naturally occurring antibiotic compound that belongs to the class of depsipeptides. It is produced by certain species of the bacterium *Streptomyces*, which are known for their ability to synthesize a wide variety of bioactive secondary metabolites. The chemical structure of depsidomycin features a unique arrangement of amino acids and a lactone moiety, contributing to its biological activity. This compound exhibits antimicrobial properties, particularly against various Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic development. Depsidomycin's mechanism of action typically involves inhibition of bacterial protein synthesis, which is crucial for bacterial growth and replication. Additionally, its potential therapeutic applications are being explored in the context of treating infections caused by resistant bacterial strains. As with many antibiotics, the study of depsidomycin also encompasses its pharmacokinetics, toxicity, and the development of derivatives to enhance its efficacy and reduce side effects.
Formula:C38H65N9O9
InChI:InChI=1/C38H65N9O9/c1-10-23(8)30(39-19-48)34(51)45-31-24(9)56-38(55)28-14-12-16-41-47(28)36(53)26(18-21(4)5)43-33(50)27-13-11-15-40-46(27)37(54)29(22(6)7)44-32(49)25(17-20(2)3)42-35(31)52/h19-31,40-41H,10-18H2,1-9H3,(H,39,48)(H,42,52)(H,43,50)(H,44,49)(H,45,51)
Synonyms:- Pentanamide, N-(docosahydro-7-methyl-14-(1-methylethyl)-11,23-bis(2-methylpropyl)-5,9,12,15,21,24-hexaoxo-7H,17H-dipyridazino(6,1-c:6',1'-i')(1,4,7,10,13,16)oxapentaazacyclononadecin-8-yl)-2-(formylamino)-3-methyl-
- Antibiotic MI 951-65F2
- N~2~-formyl-N-[7-methyl-11,23-bis(2-methylpropyl)-5,9,12,15,21,24-hexaoxo-14-(propan-2-yl)docosahydro-7H,17H-dipyridazino[6,1-c:6',1'-i][1,4,7,10,13,16]oxapentaazacyclononadecin-8-yl]isoleucinamide
- Pentanamide, N-(docosahydro-7-methyl-14-(1-methylethyl)-11,23-bis(2-methylpropyl)-5,9,12,15,21,24-hexaoxo-7H,17H-dipyridazino(6,1-c:6',1'-i)(1,4,7,10,13,16) oxapentazacyclononadecin-8-yl)-2-(formylamino)-3-methyl-
- Depsidomycin
- depsidomycin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Depsidomycin
CAS:Depsidomycin is an immunomodulatory antibiotic isolated from the culture broth of Streptomyces lavendofoliae MI951-62F2, exhibiting immunosuppressive properties. It primarily shows antibacterial activity against Gram-positive bacteria.Formula:C38H65N9O9Color and Shape:SolidMolecular weight:791.978
