CAS 131961-44-9
:alpha-((2-(Dimethylamino)ethoxy)methyl)-4-fluorobenzenemethanol hydroc hloride
Description:
Alpha-((2-(Dimethylamino)ethoxy)methyl)-4-fluorobenzenemethanol hydrochloride, with CAS number 131961-44-9, is a chemical compound characterized by its complex structure, which includes a fluorobenzene moiety and a dimethylaminoethoxy group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the presence of hydroxyl and ether functionalities. The dimethylamino group may impart basicity, influencing its reactivity and interaction with other chemical species. Additionally, the presence of the fluorine atom can enhance lipophilicity and alter the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. The hydrochloride salt form indicates that it is likely to be more stable and soluble in aqueous environments, which is advantageous for biological applications. Overall, this compound's unique structural features suggest potential utility in pharmaceutical research, particularly in the development of therapeutic agents.
Formula:C12H19ClFNO2
InChI:InChI=1/C12H18FNO2.ClH/c1-14(2)7-8-16-9-12(15)10-3-5-11(13)6-4-10;/h3-6,12,15H,7-9H2,1-2H3;1H
SMILES:CN(C)CCOCC(c1ccc(cc1)F)O.Cl
Synonyms:- Benzenemethanol, alpha-((2-(dimethylamino)ethoxy)methyl)-4-fluoro-, hydrochloride
- alpha-((2-(Dimethylamino)ethoxy)methyl)-4-fluorobenzenemethanol hydrochloride
- 2-[2-(Dimethylamino)Ethoxy]-1-(4-Fluorophenyl)Ethanol Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenemethanol, α-[[2-(dimethylamino)ethoxy]methyl]-4-fluoro-, hydrochloride (1:1)
CAS:Formula:C12H19ClFNO2Molecular weight:263.7362
