CAS 1319746-47-8
:[C(Z)]-3-Chloro-N′-hydroxybenzenecarboximidamide
Description:
[C(Z)]-3-Chloro-N′-hydroxybenzenecarboximidamide, with the CAS number 1319746-47-8, is a chemical compound characterized by its unique functional groups and structural features. It contains a chloro substituent on a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of a hydroxy group and a carboximidamide moiety indicates that it may exhibit both acidic and basic properties, allowing for interactions in various chemical environments. This compound may be of interest in medicinal chemistry due to its potential biological activity, possibly acting as an inhibitor or modulator in biochemical pathways. Additionally, the specific arrangement of atoms and functional groups suggests that it could participate in hydrogen bonding, influencing its solubility and stability in different solvents. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C7H7ClN2O
InChI:InChI=1S/C7H7ClN2O/c8-6-3-1-2-5(4-6)7(9)10-11/h1-4,11H,(H2,9,10)
InChI key:InChIKey=WYAJMVHDMUWQQA-UHFFFAOYSA-N
SMILES:C(=N\O)(\N)/C1=CC(Cl)=CC=C1
Synonyms:- [C(Z)]-3-Chloro-N′-hydroxybenzenecarboximidamide
- Benzenecarboximidamide, 3-chloro-N′-hydroxy-, [C(Z)]-
- 3-Chloro-N′-hydroxybenzenecarboximidamide
- 3-Chloro-N-hydroxy-benzamidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.