CymitQuimica logo

CAS 131981-74-3

:

Thiophene, 2-(2-nitro-1-propenyl)-, (Z)-

Description:
Thiophene, 2-(2-nitro-1-propenyl)-, (Z)- is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a nitro group and a propenyl substituent indicates that this compound has potential reactivity and may participate in various chemical reactions, such as electrophilic substitution or nucleophilic addition. The (Z)- configuration suggests that the substituents around the double bond are on the same side, which can influence the compound's physical properties and reactivity. Typically, compounds like this may exhibit interesting electronic properties due to the conjugation between the thiophene and the nitro group, making them of interest in materials science and organic electronics. Additionally, the presence of the nitro group may impart polar characteristics, affecting solubility and interaction with other molecules. Overall, this compound's unique structure and functional groups suggest potential applications in organic synthesis and possibly in the development of new materials or pharmaceuticals.
Formula:C7H7NO2S
InChI:InChI=1S/C7H7NO2S/c1-6(8(9)10)5-7-3-2-4-11-7/h2-5H,1H3/b6-5-
InChI key:InChIKey=HMPLFCAOIJOKGX-WAYWQWQTSA-N
SMILES:C(=C(\N(=O)=O)/C)\C1=CC=CS1
Synonyms:
  • Thiophene, 2-(2-nitro-1-propenyl)-, (Z)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.