CAS 131981-75-4

1-bromo-4-[(1E)-2-nitroprop-1-en-1-yl]benzene

Description:

1-Bromo-4-[(1E)-2-nitroprop-1-en-1-yl]benzene is an organic compound characterized by the presence of a bromine atom and a nitro-substituted alkenyl group attached to a benzene ring. This compound features a bromobenzene structure, where the bromine is located at the para position relative to the nitropropene substituent. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the reactivity and stability of the compound. The presence of the double bond in the propene moiety introduces additional reactivity, making it susceptible to electrophilic addition reactions. This compound may exhibit moderate to high lipophilicity due to the aromatic ring, which can affect its solubility in organic solvents. Additionally, the compound's structure suggests potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in the synthesis of more complex molecules. Safety considerations should be taken into account due to the presence of both bromine and nitro groups, which can pose health and environmental risks.

Formula: C₉H₈BrNO₂

InChI: InChI=1/C9H8BrNO2/c1-7(11(12)13)6-8-2-4-9(10)5-3-8/h2-6H,1H3/b7-6+

Synonyms:

• 1-Bromo-4-[(1E)-2-nitro-1-propen-1-yl]benzene
• benzene, 1-bromo-4-[(1E)-2-nitro-1-propen-1-yl]-

Benzene, 1-bromo-4-[(1E)-2-nitro-1-propen-1-yl]-

CAS: 131981-75-4

Formula: C₉H₈BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 242.0693

Ref: IN-DA001007

(E)-1-Bromo-4-(2-nitroprop-1-en-1-yl)benzene

CAS: 131981-75-4

Formula: C₉H₈BrNO₂

Purity: 97.0%

Molecular weight: 242.072

Ref: 10-F516583

(E)-1-Bromo-4-(2-nitroprop-1-en-1-yl)benzene

CAS: 131981-75-4

(E)-1-Bromo-4-(2-nitroprop-1-en-1-yl)benzene is an organic compound with a benzene ring. It is stabilized by the dihedral angle and has a crystal structure. The condensation reaction of ethyl nitrite and 1,2-dibromoethane was found to produce (E)-1-bromo-4-(2-nitroprop-1-en-1-yl)benzene. This compound is used in the synthesis of other chemicals, such as azo dyes.

Formula: C₉H₈BrNO₂

Purity: Min. 95%

Molecular weight: 242.07 g/mol

Ref: 3D-GFA98175