CAS 131986-05-5

4-Acetyl-1-naphthalenecarboxylic acid

Description:

4-Acetyl-1-naphthalenecarboxylic acid is an organic compound characterized by its naphthalene backbone, which is a fused bicyclic aromatic hydrocarbon. This compound features an acetyl group and a carboxylic acid functional group, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of both the acetyl and carboxylic acid groups allows for various chemical transformations, making it useful in the synthesis of more complex molecules. Additionally, its structure may impart specific properties such as fluorescence or the ability to participate in hydrogen bonding, which can influence its behavior in different chemical environments. The compound's CAS number, 131986-05-5, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 4-Acetyl-1-naphthalenecarboxylic acid is of interest in fields such as medicinal chemistry and materials science due to its versatile functional groups and aromatic characteristics.

Formula: C₁₃H₁₀O₃

InChI: InChI=1S/C13H10O3/c1-8(14)9-6-7-12(13(15)16)11-5-3-2-4-10(9)11/h2-7H,1H3,(H,15,16)

InChI key: InChIKey=DOCFRBZXXQJPBD-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C2=C(C(C(O)=O)=CC1)C=CC=C2

Synonyms:

• 1-Naphthalenecarboxylic acid, 4-acetyl-
• 4-Acetyl-1-naphthalenecarboxylic acid

1-Naphthalenecarboxylic acid, 4-acetyl-

CAS: 131986-05-5

Formula: C₁₃H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.2167

Ref: IN-DA00100X

4-Acetyl-1-naphthoic acid

CAS: 131986-05-5

4-Acetyl-1-naphthoic acid

Formula: C₁₃H₁₀O₃

Purity: 97%

Color and Shape: faint yellow powder

Molecular weight: 214.22g/mol

Ref: 54-OR31056

4-Acetyl-1-naphthoic acid

CAS: 131986-05-5

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.2200012

Ref: 10-F620783