CymitQuimica logo

CAS 131998-54-4

:

Westiellamide

Description:
Westiellamide, with the CAS number 131998-54-4, is a naturally occurring compound that belongs to the class of alkaloids. It is derived from certain marine organisms, particularly from the Westiella genus of marine sponges. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Westiellamide has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic activities. Its unique structure allows it to interact with various biological targets, making it a subject of research for developing new therapeutic agents. Additionally, studies have indicated that Westiellamide may exhibit selective activity against certain cancer cell lines, highlighting its potential as a lead compound in cancer treatment research. As with many natural products, the extraction and synthesis of Westiellamide can be challenging, but ongoing research continues to explore its applications in drug discovery and development.
Formula:C27H42N6O6
InChI:InChI=1S/C27H42N6O6/c1-10(2)16-25-31-20(13(7)37-25)23(35)29-18(12(5)6)27-33-21(15(9)39-27)24(36)30-17(11(3)4)26-32-19(14(8)38-26)22(34)28-16/h10-21H,1-9H3,(H,28,34)(H,29,35)(H,30,36)/t13-,14-,15-,16+,17+,18+,19+,20+,21+/m1/s1
InChI key:InChIKey=MIDTUAMKJJDHAR-YAWPOEEYSA-N
SMILES:[C@@H](C)(C)[C@H]1C2=N[C@@]([C@@H](C)O2)(C(=O)N[C@@H]([C@@H](C)C)C3=N[C@@]([C@@H](C)O3)(C(=O)N[C@@H]([C@@H](C)C)C4=N[C@](C(=O)N1)([C@@H](C)O4)[H])[H])[H]
Synonyms:
  • 6,13,20-Trioxa-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.15,8.112,15]tetracosa-5(24),12(23),19(22)-triene-2,9,16-trione, 7,14,21-trimethyl-4,11,18-tris(1-methylethyl)-, [1S-(1R*,4R*,7S*,8R*,11R*,14S*,15R*,18R*,21S*)]-
  • Westiellamide
  • (1S,4S,7R,8S,11S,14R,15S,18S,21R)-7,14,21-Trimethyl-4,11,18-tris(1-methylethyl)-6,13,20-trioxa-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.15,8.112,15]tetracosa-5(24),12(23),19(22)-triene-2,9,16-trione
  • 6,13,20-Trioxa-3,10,17,22,23,24-hexaazatetracyclo[17.2.1.15,8.112,15]tetracosa-5(24),12(23),19(22)-triene-2,9,16-trione, 7,14,21-trimethyl-4,11,18-tris(1-methylethyl)-, (1S,4S,7R,8S,11S,14R,15S,18S,21R)-
  • Cycloxazoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.