CymitQuimica logo

CAS 132-38-7

:

6-(Acetylamino)-3-[2-[4-(aminosulfonyl)phenyl]diazenyl]-4-hydroxy-2,7-naphthalenedisulfonic acid

Description:
6-(Acetylamino)-3-[2-[4-(aminosulfonyl)phenyl]diazenyl]-4-hydroxy-2,7-naphthalenedisulfonic acid, commonly known as Acid Orange 7, is a synthetic azo dye characterized by its vibrant orange color. This compound features a complex molecular structure that includes multiple functional groups, such as sulfonic acid and acetylamino groups, which enhance its solubility in water and contribute to its application in various industries. Acid Orange 7 is primarily used in textile dyeing, paper manufacturing, and as a biological stain due to its ability to bind to proteins and other cellular components. The presence of the azo group (-N=N-) is significant, as it is responsible for the dye's chromophoric properties, allowing it to absorb visible light and impart color. Additionally, the sulfonic acid groups improve the dye's affinity for substrates and its overall stability in aqueous solutions. However, like many azo dyes, it is essential to consider its environmental impact and potential toxicity, prompting regulations in certain applications.
Formula:C18H16N4O10S3
InChI:InChI=1S/C18H16N4O10S3/c1-9(23)20-14-8-13-10(6-15(14)34(27,28)29)7-16(35(30,31)32)17(18(13)24)22-21-11-2-4-12(5-3-11)33(19,25)26/h2-8,24H,1H3,(H,20,23)(H2,19,25,26)(H,27,28,29)(H,30,31,32)
InChI key:InChIKey=RALNLQYPLYWQRT-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(S(=O)(=O)O)C1N=NC3=CC=C(S(N)(=O)=O)C=C3)C=C(S(=O)(=O)O)C(NC(C)=O)=C2
Synonyms:
  • 6-(Acetylamino)-3-[2-[4-(aminosulfonyl)phenyl]diazenyl]-4-hydroxy-2,7-naphthalenedisulfonic acid
  • 2,7-Naphthalenedisulfonic acid, 6-acetamido-4-hydroxy-3-[(p-sulfamoylphenyl)azo]-
  • 2,7-Naphthalenedisulfonic acid, 6-(acetylamino)-3-[[4-(aminosulfonyl)phenyl]azo]-4-hydroxy-
  • Neoprontosil
  • 2,7-Naphthalenedisulfonic acid, 6-(acetylamino)-3-[2-[4-(aminosulfonyl)phenyl]diazenyl]-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.