CAS 132-49-0
:Magnesium acetylsalicylate
Description:
Magnesium acetylsalicylate, with the CAS number 132-49-0, is a chemical compound that is a salt formed from magnesium and acetylsalicylic acid, commonly known as aspirin. This compound typically appears as a white crystalline powder and is soluble in water, which enhances its bioavailability. Magnesium acetylsalicylate is often used for its analgesic and anti-inflammatory properties, making it beneficial in treating pain and inflammation. The presence of magnesium in the compound can also contribute to its potential role in alleviating muscle cramps and promoting overall muscle function. As a derivative of acetylsalicylic acid, it retains the therapeutic effects associated with aspirin, such as antipyretic and anti-inflammatory actions, while potentially offering a different side effect profile. However, like other salicylates, it may still pose risks of gastrointestinal irritation and bleeding. Proper handling and dosage are essential to minimize adverse effects, and it is advisable to consult healthcare professionals before use, especially in individuals with pre-existing conditions or those taking other medications.
Formula:C9H8O4Mg
InChI:InChI=1S/C9H8O4.Mg/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;/h2-5H,1H3,(H,11,12);
InChI key:InChIKey=SEEIIJMJVPCRPS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC(C)=O)C=CC=C1.[Mg]
Synonyms:- Benzoic acid, 2-(acetyloxy)-, magnesium salt
- Algicina
- Acetylsalicylic acid, magnesium salt
- Benzoic acid, 2-(acetyloxy)-, magnesium salt (2:1)
- Salicylic acid acetate, magnesium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
