CAS 132-54-7
:Phenyl 1-hydroxy-2-naphthoate
Description:
Phenyl 1-hydroxy-2-naphthoate, also known as 1-hydroxy-2-naphthoic acid phenyl ester, is an organic compound characterized by its naphthalene structure, which consists of two fused benzene rings. This compound features a hydroxyl group (-OH) and an ester functional group, contributing to its chemical reactivity and solubility properties. It is typically a white to pale yellow solid, exhibiting moderate solubility in organic solvents while being less soluble in water. Phenyl 1-hydroxy-2-naphthoate is primarily used in the synthesis of various chemical intermediates and as a potential additive in polymer formulations due to its UV-absorbing properties. Its applications extend to the fields of dyes, pharmaceuticals, and agrochemicals. The compound is known for its stability under normal conditions, although it may undergo degradation when exposed to strong acids or bases. Safety data indicates that it should be handled with care, as with many organic compounds, to avoid potential health hazards associated with exposure.
Formula:C17H12O3
InChI:InChI=1S/C17H12O3/c18-16-14-9-5-4-6-12(14)10-11-15(16)17(19)20-13-7-2-1-3-8-13/h1-11,18H
InChI key:InChIKey=QHDYIMWKSCJTIM-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC1C(OC3=CC=CC=C3)=O)C=CC=C2
Synonyms:- 1-Hydroxy-2-Naphthoic Acid Phenyl Ester
- 2-Naphthalenecarboxylic acid, 1-hydroxy-, phenyl ester
- 2-Naphthoic acid, 1-hydroxy-, phenyl ester
- 2-Phenoxycarbonyl-1-naphthol
- Hs 1094
- NSC 1867
- Phenyl 1-Hydroxynaphthalene-2-Carboxylate
- Phenyl 1-hydroxy-2-naphthalate
- Phenyl 1-hydroxy-2-naphthalenecarboxylate
- Phenyl-1-hydroxy-2-naphthate
- Phenyl 1-hydroxy-2-naphthoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phenyl 1-Hydroxy-2-naphthoate
CAS:Formula:C17H12O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:264.282-Naphthalenecarboxylic acid, 1-hydroxy-, phenyl ester
CAS:Formula:C17H12O3Purity:98%Color and Shape:SolidMolecular weight:264.2754Phenyl 1-Hydroxy-2-Naphthoate
CAS:<p>Phenyl 1-Hydroxy-2-Naphthoate</p>Purity:98%+Molecular weight:264.28g/molPhenyl 1-hydroxy-2-naphthoate
CAS:<p>Phenyl 1-Hydroxy-2-naphthoate is a protonated molecule that contains an intramolecular hydrogen bond. The dipole moment of this molecule is 1.54 D, which is the product of the charge on the proton and the distance between it and the oxygen atom. The chloride ion forms a hydrogen bond with the hydroxyl group of the phenyl ring, which stabilizes its structure. This compound has a molecular weight of 192.1 g/mol and is soluble in water, hydrochloric acid, and solvents such as acetone or acetonitrile. Phenyl 1-Hydroxy-2-naphthoate has been shown to be an acceptor for chlorine at room temperature.</p>Formula:C17H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:264.28 g/mol





