CAS 13201-14-4

Dihydrocucurbitacin B

Description:

Dihydrocucurbitacin B is a naturally occurring triterpenoid compound derived from various plant sources, particularly within the Cucurbitaceae family. It is characterized by its complex tetracyclic structure, which contributes to its biological activity. This compound exhibits a range of pharmacological properties, including anti-inflammatory, anticancer, and antimicrobial effects, making it of interest in medicinal chemistry and pharmacology. Dihydrocucurbitacin B is typically found in low concentrations in plants, necessitating extraction and purification for research and potential therapeutic applications. Its mechanism of action often involves modulation of signaling pathways related to cell proliferation and apoptosis. Additionally, it is important to note that the compound's solubility and stability can vary depending on environmental conditions, which may influence its bioavailability and efficacy. As research continues, the potential applications of dihydrocucurbitacin B in drug development and natural product chemistry are being explored, highlighting its significance in the field of natural compounds.

Formula: C₃₂H₄₈O₈

InChI: InChI=1S/C32H48O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,19-22,25,34-35,39H,11-16H2,1-9H3/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1

InChI key: InChIKey=QZJJDOYZVRUEDY-NRNCYQGDSA-N

SMILES: C[C@]12[C@@](C)([C@@]([C@@](C(CCC(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)C(=O)C4(C)C)[H])[H]

Synonyms:

• Dihydrocucurbitacin B
• Cucurbitacin B, dihydro-
• (2β,9β,10α,16α)-25-(Acetyloxy)-2,16,20-trihydroxy-9-methyl-19-norlanost-5-ene-3,11,22-trione
• 19-Nor-9β,10α-lanost-5-ene-3,11,22-trione, 2β,16α,20,25-tetrahydroxy-9-methyl-, 25-acetate
• 19-Norlanost-5-ene-3,11,22-trione, 25-(acetyloxy)-2,16,20-trihydroxy-9-methyl-, (2β,9β,10α,16α)-

Dihydrocucurbitacin B

CAS: 13201-14-4

Dihydrocucurbitacin B (23,24-dihydrocucurbitacin B) is isolated from the roots of Cayaponia tayuya with anti-cancer activity.

Formula: C₃₂H₄₈O₈

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 560.72

Ref: TM-TN1579

Dihydrocucurbitacin B

CAS: 13201-14-4

Dihydrocucurbitacin B

Purity: ≥98%

Molecular weight: 560.72g/mol

Ref: 54-BUP00217

Dihydrocucurbitacin B

CAS: 13201-14-4

Formula: C₃₂H₄₈O₈

Molecular weight: 560.73

Ref: 7W-GY8067

Dihydrocucurbitacin B

CAS: 13201-14-4

Formula: C₃₂H₄₈O₈

Purity: 95%~99%

Molecular weight: 560.73

Ref: BP-BPF2140

Dihydrocucurbitacin B

Controlled Product

CAS: 13201-14-4

Dihydrocucurbitacin B is a glycoside derivative that belongs to the class of antimicrobial agents. It has been shown to inhibit the growth of human cervical cancer cells and epidermal growth factor-induced skin cancer cells in mice. This drug also inhibits the transcriptional regulation of protein synthesis, which may be due to its ability to inhibit the activity of amino transferase and chinese herb. Dihydrocucurbitacin B has been shown to have significant cytotoxicity, which may be due to its ability to inhibit uptake and complex enzyme.

Formula: C₃₂H₄₈O₈

Purity: Min. 95%

Molecular weight: 560.73 g/mol

Ref: 3D-NAA20114