CAS 13201-92-8
:1,3-bis(ethoxymethyl)urea
Description:
1,3-bis(ethoxymethyl)urea is an organic compound characterized by its urea functional group, which is modified by the presence of two ethoxymethyl groups. This structure contributes to its solubility in organic solvents and potential applications in various chemical processes. The compound typically appears as a white to off-white solid and is known for its relatively low toxicity compared to other urea derivatives. It exhibits properties such as moderate thermal stability and can participate in hydrogen bonding due to the presence of the urea moiety. Its ethoxymethyl substituents enhance its reactivity and may influence its behavior in biological systems, making it of interest in medicinal chemistry and agricultural applications. Additionally, 1,3-bis(ethoxymethyl)urea can serve as a building block in the synthesis of more complex molecules, highlighting its utility in organic synthesis. As with any chemical substance, proper handling and safety precautions should be observed to mitigate any potential risks associated with its use.
Formula:C7H16N2O3
InChI:InChI=1/C7H16N2O3/c1-3-11-5-8-7(10)9-6-12-4-2/h3-6H2,1-2H3,(H2,8,9,10)
SMILES:CCOCN=C(NCOCC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.