CAS 1320201-22-6: 1,1′-[4,8-Bis[(2-octyldodecyl)oxy]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane]
Description:1,1′-[4,8-Bis[(2-octyldodecyl)oxy]benzo[1,2-b:4,5-b′]dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane] is a complex organic compound characterized by its unique structure, which includes a dithiophene core and long alkyl chains that enhance its solubility in organic solvents. This compound features two trimethylstannane groups, which can influence its electronic properties and stability. The presence of the octyldodecyl groups contributes to its hydrophobic nature, making it suitable for applications in organic electronics, such as organic photovoltaics and field-effect transistors. The dithiophene moiety is known for its excellent charge transport properties, which are crucial for the performance of electronic devices. Additionally, the compound's synthesis involves multiple steps, typically requiring careful handling due to the presence of organotin compounds, which can be toxic. Overall, this substance is of interest in materials science and organic chemistry for its potential applications in advanced electronic materials.
Formula:C56H102O2S2Sn2
InChI:InChI=1S/C50H84O2S2.6CH3.2Sn/c1-5-9-13-17-21-23-27-31-35-43(33-29-25-19-15-11-7-3)41-51-47-45-37-39-54-50(45)48(46-38-40-53-49(46)47)52-42-44(34-30-26-20-16-12-8-4)36-32-28-24-22-18-14-10-6-2;;;;;;;;/h37-38,43-44H,5-36,41-42H2,1-4H3;6*1H3;;
InChI key:InChIKey=AZENTBKKKXIGMB-UHFFFAOYSA-N
SMILES:O(C=1C=2SC(=CC2C(OCC(CCCCCCCC)CCCCCCCCCC)=C3SC(=CC13)[Sn](C)(C)C)[Sn](C)(C)C)CC(CCCCCCCC)CCCCCCCCCC

2,6-Bis(trimethylstannyl)-4,8-bis[(2-n-octyldodecyl)oxy]benzo[1,2-b:4,5-b']dithiophene
Ref: 3B-B4488
200mg | 419.00 € |

(4,8-Bis((2-octyldodecyl)oxy)benzo[1,2-b
Ref: IN-DA009GMV
1g | 190.00 € | ||
100mg | 81.00 € | ||
250mg | 108.00 € |

2,6-Bis(trimethylstannyl)-4,8-bis[(2-n-octyldodecyl)oxy]benzo[1,2-b:4,5-b']dithiophene
Ref: 3D-VCC20122
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |