
CAS 132033-91-1
:5-(4-Piperidinyl)-3(2H)-isoxazolone
Description:
5-(4-Piperidinyl)-3(2H)-isoxazolone, identified by its CAS number 132033-91-1, is a chemical compound characterized by its isoxazolone core structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the piperidine group contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its unique structural features. Its solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. Additionally, the compound's interactions with biological systems may be influenced by its functional groups and stereochemistry, making it of interest in medicinal chemistry and related fields. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c11-8-5-7(12-10-8)6-1-3-9-4-2-6/h5-6,9H,1-4H2,(H,10,11)
InChI key:InChIKey=YYOYGSTYWVHCJR-UHFFFAOYSA-N
SMILES:O=C1C=C(ON1)C2CCNCC2
Synonyms:- 3(2H)-Isoxazolone, 5-(4-piperidinyl)-
- 5-(4-Piperidyl)-3-isoxazolol
- 5-(4-Piperidinyl)-3(2H)-isoxazolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.