CAS 132036-90-9
:Methanone, (1-methyl-1H-indol-3-yl)(4,5,6,7-tetrahydro-1H-benzimidazol-5-yl)-, (S)-
Description:
Methanone, (1-methyl-1H-indol-3-yl)(4,5,6,7-tetrahydro-1H-benzimidazol-5-yl)-, (S)-, with CAS number 132036-90-9, is a chemical compound characterized by its complex structure, which includes an indole and a benzimidazole moiety. This compound is classified as a ketone due to the presence of a carbonyl group (C=O) in its structure. The (S)- designation indicates that it has a specific stereochemistry, which can influence its biological activity and interactions. Methanone derivatives often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of both the indole and benzimidazole rings suggests potential applications in drug development, particularly in areas related to neuropharmacology or oncology. Additionally, the compound's solubility, stability, and reactivity can vary based on its molecular structure, which may affect its synthesis and application in various chemical contexts. Overall, this compound represents a unique combination of structural features that may contribute to its functional properties in biological systems.
Formula:C17H17N3O
InChI:InChI=1S/C17H17N3O/c1-20-9-13(12-4-2-3-5-16(12)20)17(21)11-6-7-14-15(8-11)19-10-18-14/h2-5,9-11H,6-8H2,1H3,(H,18,19)/t11-/m0/s1
InChI key:InChIKey=NTHPAPBPFQJABD-NSHDSACASA-N
SMILES:C(=O)(C=1C=2C(N(C)C1)=CC=CC2)[C@@H]3CC4=C(CC3)N=CN4
Synonyms:- Methanone, (1-methyl-1H-indol-3-yl)(4,5,6,7-tetrahydro-1H-benzimidazol-5-yl)-, (S)-
- Methanone, (1-methyl-1H-indol-3-yl)(4,5,6,7-tetrahydro-1H-benzimidazol-5-yl)-, (S)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
