CAS 13205-47-5
:4-(TERT-BUTOXY)BENZOIC ACID
Description:
4-(Tert-butoxy)benzoic acid, with the CAS number 13205-47-5, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a tert-butoxy group at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic tert-butoxy group. The tert-butoxy group enhances the compound's lipophilicity, which can influence its reactivity and interaction with biological systems. As a benzoic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural features make it useful in organic synthesis and as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, the compound may exhibit specific thermal and spectral properties, which can be analyzed using techniques such as NMR and IR spectroscopy for characterization and quality control purposes.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-11(2,3)14-9-6-4-8(5-7-9)10(12)13/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C)Oc1ccc(cc1)C(=O)O
Synonyms:- 4-T-Butoxybenzoic Acid
- Rarechem Al Bo 2404
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 4-(1,1-dimethylethoxy)-
CAS:Formula:C11H14O3Purity:97%Color and Shape:SolidMolecular weight:194.22714-tert-Butoxybenzoic acid
CAS:4-tert-Butoxybenzoic acidFormula:C11H14O3Purity:97%Color and Shape: light yellow to yellow solidMolecular weight:194.23g/mol4-tert-Butoxybenzoic acid
CAS:Formula:C11H14O3Purity:98.0%Color and Shape:SolidMolecular weight:194.234-tert-Butoxybenzoic acid
CAS:4-tert-Butoxybenzoic acid is a linker that is used in the synthesis of ruthenium complexes. It is used in stepwise solid-phase synthesis, where it can be used as an alkylating agent to introduce a tertiary butyl group onto the molecule. This type of reaction is often used to produce biomolecules, such as proteins and peptides. The 4-tert-butoxybenzoic acid has been shown to inhibit the growth of glioblastoma cells by alkylation and may also have anti-inflammatory properties.Formula:C11H14O3Purity:Min. 95%Color and Shape:White SolidMolecular weight:194.23 g/mol4-(tert-Butoxy)benzoic acid
CAS:4-(tert-Butoxy)benzoic acid is a useful organic compound for research related to life sciences. The catalog number is T67620 and the CAS number is 13205-47-5.Formula:C11H14O3Color and Shape:SolidMolecular weight:194.23




